Lucidenic acid SP1 (Lucidenic acid LM1) structure
|
Common Name | Lucidenic acid SP1 (Lucidenic acid LM1) | ||
|---|---|---|---|---|
| CAS Number | 364622-33-3 | Molecular Weight | 460.603 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 640.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H40O6 | Melting Point | 202-204 °C | |
| MSDS | N/A | Flash Point | 355.3±28.0 °C | |
Use of Lucidenic acid SP1 (Lucidenic acid LM1)Lucidenic acid LM1 is a natural triterpenoid isolated from Ganoderma lucidum. |
| Name | Lucidenic acid N |
|---|---|
| Synonym | More Synonyms |
| Description | Lucidenic acid LM1 is a natural triterpenoid isolated from Ganoderma lucidum. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 640.7±55.0 °C at 760 mmHg |
| Melting Point | 202-204 °C |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.603 |
| Flash Point | 355.3±28.0 °C |
| Exact Mass | 460.282501 |
| LogP | 2.55 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | YBGBNHHXOJXFNM-UQCMLMITSA-N |
| SMILES | CC(CCC(=O)O)C1CC(=O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O |
| (3β,5α,7β)-3,7-Dihydroxy-4,4,14-trimethyl-11,15-dioxochol-8-en-24-oic acid |
| Chol-8-en-24-oic acid, 3,7-dihydroxy-4,4,14-trimethyl-11,15-dioxo-, (3β,5α,7β)- |