methyl 3,4-dichloro-9-hydroxy-8-(methoxycarbonylmethyl)-10,10-dioxo-10$l^{6}-thia-7,9-diazabicyclo[4.4.0]deca-1,3,5-triene-8-carboxylate structure
|
Common Name | methyl 3,4-dichloro-9-hydroxy-8-(methoxycarbonylmethyl)-10,10-dioxo-10$l^{6}-thia-7,9-diazabicyclo[4.4.0]deca-1,3,5-triene-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36110-11-9 | Molecular Weight | 399.20400 | |
| Density | 1.633g/cm3 | Boiling Point | 553ºC at 760 mmHg | |
| Molecular Formula | C12H12Cl2N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.2ºC | |
| Name | methyl 6,7-dichloro-2-hydroxy-3-(2-methoxy-2-oxoethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.633g/cm3 |
|---|---|
| Boiling Point | 553ºC at 760 mmHg |
| Molecular Formula | C12H12Cl2N2O7S |
| Molecular Weight | 399.20400 |
| Flash Point | 288.2ºC |
| Exact Mass | 397.97400 |
| PSA | 130.62000 |
| LogP | 2.38790 |
| Index of Refraction | 1.601 |
| InChIKey | HXJIDAFJSVKUFH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(C(=O)OC)Nc2cc(Cl)c(Cl)cc2S(=O)(=O)N1O |
|
~%
methyl 3,4-dich... CAS#:36110-11-9 |
| Literature: Heindel,N.D. et al. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 118 - 120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Hydroxy-3-carbomethoxy-3-carbomethoxymethyl-6,7-dichloro-3,4-dihydro-1,2,4-benzothiadiazine 1,1-Dioxide |