3-hydroxy-3,3-diphenyl-propanoic acid structure
|
Common Name | 3-hydroxy-3,3-diphenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3609-48-1 | Molecular Weight | 242.27000 | |
| Density | 1.243g/cm3 | Boiling Point | 418.3ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | 209-211ºC | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 3-hydroxy-3,3-diphenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 418.3ºC at 760 mmHg |
| Melting Point | 209-211ºC |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 220.9ºC |
| Exact Mass | 242.09400 |
| PSA | 57.53000 |
| LogP | 2.39720 |
| Index of Refraction | 1.609 |
| InChIKey | WDPPERBMAUXJOJ-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3,3-diphenyl-3-hydroxypropanoic acid |
| 3-Hydroxy-3,3-diphenyl-propionsaeure |
| 3-hydroxy-3,3-diphenyl-propionic acid |
| 3,3-diphenyl-3-hydroxypropionic acid |