6-Nitro-5-quinolinamine structure
|
Common Name | 6-Nitro-5-quinolinamine | ||
|---|---|---|---|---|
| CAS Number | 35975-00-9 | Molecular Weight | 189.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 409.4±30.0 °C at 760 mmHg | |
| Molecular Formula | C9H7N3O2 | Melting Point | 272-273 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 201.4±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-nitroquinolin-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.4±30.0 °C at 760 mmHg |
| Melting Point | 272-273 °C (dec.)(lit.) |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.171 |
| Flash Point | 201.4±24.6 °C |
| Exact Mass | 189.053833 |
| PSA | 84.73000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.743 |
| InChIKey | TYBYHEXFKFLRFT-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])ccc2ncccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2933499090 |
|
~%
6-Nitro-5-quino... CAS#:35975-00-9 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 20, # 9 p. 744 - 746 |
|
~95%
6-Nitro-5-quino... CAS#:35975-00-9 |
| Literature: Makosza, Mieczyslaw; Bialecki, Maciej Journal of Organic Chemistry, 1998 , vol. 63, # 15 p. 4878 - 4888 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Genotoxicity, carcinogenicity, and mode of action of the fried food mutagen 2-amino-3-methylimidazo[4,5-f]quinoline (IQ).
Environ. Health Perspect. 67 , 121, (1986) Because mutagens typified by 2-amino-3-methylimidazo[4,5-f]quinoline (IQ) observed in cooked foods are widely consumed, detailed studies of their biochemical and biological properties including carcin... |
|
|
Determination of 5-amino-6-nitroquinoline at a carbon paste electrode. Nemcová L, et al.
Collect. Czech. Chem. Commun. 74(10) , 1477-88, (2009)
|
| 5-Amino-6-nitroquinoline |
| 6-nitro-5-quinolylamine |
| 5-amine-6-nitroquinoline |
| 6-nitro-quinolin-5-ylamine |
| 5-Quinolinamine,6-nitro |
| 6-nitroquinolin-5-amine |
| 5-Quinolinamine, 6-nitro- |
| EINECS 252-822-6 |
| 6-Nitro-5-quinolinamine |
| 6-Nitro-[5]chinolylamin |
| MFCD00006798 |