Cinerubin B
Modify Date: 2024-01-11 14:51:19
Cinerubin B structure
|
Common Name | Cinerubin B | ||
|---|---|---|---|---|
| CAS Number | 35906-51-5 | Molecular Weight | 825.85100 | |
| Density | 1.48g/cm3 | Boiling Point | 897ºC at 760mmHg | |
| Molecular Formula | C42H51NO16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 496.3ºC | |
Use of Cinerubin BCinerubin B, a glycosylated anthracycline antibiotic, is an anticancer agent from Streptomyces sp. SPB74[1]. |
| Name | 1-Naphthacenecarboxylic acid, 4-[[(2''',3''-anhydro)-O-3,6-dideoxy-.α.-L-erythro-hexopyranos-4-uloslyl-(1.fwdarw.4)-O-2,6-dideoxy-.α.-L-lyxo-hexopyranosyl-(1.fwdarw.4)-2,3,6-trideoxy-3-(dimethylamino)-.α.-L-lyxo-hexopyranosyl]oxy]-2-ethyl-1,2, |
|---|---|
| Synonym | More Synonyms |
| Description | Cinerubin B, a glycosylated anthracycline antibiotic, is an anticancer agent from Streptomyces sp. SPB74[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 897ºC at 760mmHg |
| Molecular Formula | C42H51NO16 |
| Molecular Weight | 825.85100 |
| Flash Point | 496.3ºC |
| Exact Mass | 825.32100 |
| PSA | 226.28000 |
| LogP | 2.87970 |
| Index of Refraction | 1.646 |
| InChIKey | ZBDDFHXUDIPRSM-DQCCILMQSA-N |
| SMILES | CCC1(O)CC(OC2CC(N(C)C)C(OC3CC4OC5CC(=O)C(C)OC5OC4C(C)O3)C(C)O2)c2c(cc3c(c2O)C(=O)c2c(O)ccc(O)c2C3=O)C1C(=O)OC |
| cinerubin B |
| cinerubine B |
| 1-hydroxyaclacinomycin B |