[R-(Z)]-12-hydroxy-9-octadecenamide
Modify Date: 2025-08-24 23:24:38
![[R-(Z)]-12-hydroxy-9-octadecenamide Structure](https://image.chemsrc.com/caspic/201/35732-94-6.png)
[R-(Z)]-12-hydroxy-9-octadecenamide structure
|
Common Name | [R-(Z)]-12-hydroxy-9-octadecenamide | ||
|---|---|---|---|---|
| CAS Number | 35732-94-6 | Molecular Weight | 297.47600 | |
| Density | 0.935g/cm3 | Boiling Point | 476.7ºC at 760mmHg | |
| Molecular Formula | C18H35NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | (E)-12-hydroxyoctadec-9-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.935g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760mmHg |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.47600 |
| Flash Point | 242.1ºC |
| Exact Mass | 297.26700 |
| PSA | 64.31000 |
| LogP | 5.62970 |
| Index of Refraction | 1.481 |
| InChIKey | VSKRSEHLMRRKOS-FMIVXFBMSA-N |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(N)=O |
| HS Code | 2924199090 |
|---|
|
~%
[R-(Z)]-12-hydr... CAS#:35732-94-6 |
| Literature: Galstukhova,N.B. J. Gen. Chem. USSR (Engl. Transl.), 1960 , vol. 30, p. 1387 - 1389,1418 - 1420 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ricinolamide |
| Ricinolsaeure-amid |
| EINECS 252-703-9 |
| ricinoleamide |