[R-(Z)]-N-[3-(dimethylamino)propyl]-12-hydroxy-9-octadecenamide structure
|
Common Name | [R-(Z)]-N-[3-(dimethylamino)propyl]-12-hydroxy-9-octadecenamide | ||
|---|---|---|---|---|
| CAS Number | 20457-75-4 | Molecular Weight | 382.62400 | |
| Density | 0.926g/cm3 | Boiling Point | 537.9ºC at 760mmHg | |
| Molecular Formula | C23H46N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.1ºC | |
| Name | N-[3-(Dimethylamino)propyl]-12-hydroxy-9-octadecenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.926g/cm3 |
|---|---|
| Boiling Point | 537.9ºC at 760mmHg |
| Molecular Formula | C23H46N2O2 |
| Molecular Weight | 382.62400 |
| Flash Point | 279.1ºC |
| Exact Mass | 382.35600 |
| PSA | 56.06000 |
| LogP | 5.90290 |
| Vapour Pressure | 8.2E-14mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | DWIUBTKCNCCGOO-QOYCNBSOSA-N |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(=O)NCCCN(C)C |
| HS Code | 2924199090 |
|---|
|
~%
[R-(Z)]-N-[3-(d... CAS#:20457-75-4 |
| Literature: NL Industries, Inc. Patent: US4220581 A1, 1980 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2(3H)-Furanthione,dihydro-5-phenyl |