Albaspidin AA structure
|
Common Name | Albaspidin AA | ||
|---|---|---|---|---|
| CAS Number | 3570-40-9 | Molecular Weight | 404.410 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 649.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.4±28.0 °C | |
Use of Albaspidin AAAlbaspidin AA displays strong antibacterial activity against the vegetative form of Paenibacillus larvae (P. larvae) (MIC=220 μM)[1]. |
| Name | 2,2'-Methylenebis(6-acetyl-3,5-dihydroxy-4,4-dimethyl-2,5-cyclohe xadien-1-one) |
|---|---|
| Synonym | More Synonyms |
| Description | Albaspidin AA displays strong antibacterial activity against the vegetative form of Paenibacillus larvae (P. larvae) (MIC=220 μM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 649.1±55.0 °C at 760 mmHg |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.410 |
| Flash Point | 360.4±28.0 °C |
| Exact Mass | 404.147125 |
| PSA | 149.20000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | OBCJMBQBESJUST-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(O)C(CC2=C(O)C(C)(C)C(=O)C(C(C)=O)=C2O)=C(O)C(C)(C)C1=O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Ala-Val-NH2 |
| 2,5-Cyclohexadien-1-one, 2,2'-methylenebis[6-acetyl-3,5-dihydroxy-4,4-dimethyl- |
| H-ALA-VAL-NH2 HCL |
| H-Ala-Val-NH2 |
| 2,2'-Methylenebis(6-acetyl-3,5-dihydroxy-4,4-dimethyl-2,5-cyclohexadien-1-one) |
| Albaspidin AA |