2,2',5,5'-PCB structure
|
Common Name | 2,2',5,5'-PCB | ||
|---|---|---|---|---|
| CAS Number | 35693-99-3 | Molecular Weight | 291.988 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 344.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Cl4 | Melting Point | 87℃ | |
| MSDS | Chinese USA | Flash Point | 161.9±23.9 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 2,2',5,5'-tetrachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 344.9±37.0 °C at 760 mmHg |
| Melting Point | 87℃ |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.988 |
| Flash Point | 161.9±23.9 °C |
| Exact Mass | 289.922363 |
| LogP | 5.92 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | HCWZEPKLWVAEOV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(-c2cc(Cl)ccc2Cl)c1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H373-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment;F: Flammable; |
| Risk Phrases | R33 |
| Safety Phrases | 35-60-61-62-16 |
| RIDADR | UN 2315 |
| RTECS | DV8660000 |
| Packaging Group | II |
| Hazard Class | 9 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Temporal trends of selected POPs and the potential influence of climate variability in a Greenland ringed seal population.
Environ. Sci. Process. Impacts 15(9) , 1706-16, (2013) Temporal trends of selected POPs (PCB-52 and 153, p,p'-DDE, HCB, α- and β-HCH) in blubber of ringed seals (Pusa hispida) collected from the early 1990s to 2010 from central West Greenland were studied... |
|
|
Vertical distributions of organochlorine pesticides and polychlorinated biphenyls in an agricultural soil core from the Guanzhong Basin, China.
Environ. Monit. Assess. 187(1) , 4159, (2015) The concentrations and distributions of hexachlorocyclohexanes (HCHs), dichlorodiphenyltrichloroethanes (DDTs), and polychlorinated biphenyls (PCBs) in an agricultural soil core in the Guanzhong Basin... |
|
|
Dopamine-dependent behavior in adult rats after perinatal exposure to purity-controlled polychlorinated biphenyl congeners (PCB52 and PCB180).
Toxicol. Lett. 224(1) , 32-9, (2014) Since knowledge about toxic effects of non-dioxinlike (NDL) PCBs is fragmentary, regulatory panels have concluded that risk assessment of these congeners is hampered or impossible. As the dopaminergic... |
| 2,2',3,3',4,5',6,6'-OCTACHLOROBIPHENYL |
| EINECS 208-759-1 |
| 2,2',5,5'-tetrachlorbiphenyl |
| 2,5,2',5'-Tetrachlorobiphenyl |
| 1,1'-Biphenyl, 2,2',5,5'-tetrachloro- |
| 2,2',5,5'-Tétrachlorobiphényl |
| 1,4-dichloro-2-(2,5-dichlorophenyl)benzene |
| 1,1'-Biphenyl,2,2',5,5'-tetrachloro |
| 2,2',5,5'-Tetrachlorobiphenyl |
| 2,2',5,5'-PCB |
| MFCD00055544 |
| 2,2',5,5'-TCB |
| 2,2',5,5'-Tetrachloro-1,1'-biphenyl |
| 2,3',5,6'-Tetrachlorobiphenyl |
| TCBP |
| PCB 52 |