Carbamic acid, [1-[(phenylmethoxy)imino]propyl]-, ethyl ester (9CI) structure
|
Common Name | Carbamic acid, [1-[(phenylmethoxy)imino]propyl]-, ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 35675-20-8 | Molecular Weight | 250.29400 | |
| Density | 1.08g/cm3 | Boiling Point | 341ºC at 760mmHg | |
| Molecular Formula | C13H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | ethyl N-[1-(phenylmethoxyamino)propylidene]carbamate |
|---|
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 341ºC at 760mmHg |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.29400 |
| Flash Point | 160ºC |
| Exact Mass | 250.13200 |
| PSA | 59.92000 |
| LogP | 3.06370 |
| Index of Refraction | 1.51 |
| InChIKey | SFWYRBWPMCZLKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(CC)=NOCc1ccccc1 |
|
~%
Carbamic acid, ... CAS#:35675-20-8 |
| Literature: Coviello; Dvorin; Greenberg Journal of medicinal chemistry, 1972 , vol. 15, # 1 p. 94 - 95 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |