N,N-dimethyl-4-[(6-methylbenzothiazol-2-yl)iminomethyl]aniline structure
|
Common Name | N,N-dimethyl-4-[(6-methylbenzothiazol-2-yl)iminomethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 35525-73-6 | Molecular Weight | 295.40200 | |
| Density | 1.16g/cm3 | Boiling Point | 466.8ºC at 760 mmHg | |
| Molecular Formula | C17H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | N,N-dimethyl-4-[(6-methyl-1,3-benzothiazol-2-yl)iminomethyl]aniline |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 466.8ºC at 760 mmHg |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.40200 |
| Flash Point | 236.1ºC |
| Exact Mass | 295.11400 |
| PSA | 56.73000 |
| LogP | 4.42130 |
| Index of Refraction | 1.635 |
| InChIKey | RHAGGLRVIJQESM-WOJGMQOQSA-N |
| SMILES | Cc1ccc2nc(N=Cc3ccc(N(C)C)cc3)sc2c1 |
| HS Code | 2934999090 |
|---|
|
~%
N,N-dimethyl-4-... CAS#:35525-73-6 |
| Literature: Mazumdar,A.K.D. et al. Journal of the Indian Chemical Society, 1979 , vol. 56, p. 999 - 1001 |
|
~%
N,N-dimethyl-4-... CAS#:35525-73-6 |
| Literature: Prot,T.; Parol,J. Roczniki Chemii, 1971 , vol. 45, p. 1301 - 1313 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |