perfluorocyclohexane structure
|
Common Name | perfluorocyclohexane | ||
|---|---|---|---|---|
| CAS Number | 355-68-0 | Molecular Weight | 300.04500 | |
| Density | 1.684 | Boiling Point | 59-60°C | |
| Molecular Formula | C6F12 | Melting Point | 51 °C (subl.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorocyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.684 |
|---|---|
| Boiling Point | 59-60°C |
| Melting Point | 51 °C (subl.)(lit.) |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04500 |
| Exact Mass | 299.98100 |
| LogP | 3.81180 |
| Index of Refraction | 1.2685 |
| InChIKey | RKIMETXDACNTIE-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| HS Code | 2903890090 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Dodecafluorocyclohexane |
| Cyclohexane,dodecafluoro |
| EINECS 206-591-3 |
| MFCD00003821 |
| Dodekafluorcyclohexan |
| perfluorocyclo-hexane |
| Dodecafluor-cyclohexan |