Perfluorohexane structure
|
Common Name | Perfluorohexane | ||
|---|---|---|---|---|
| CAS Number | 355-42-0 | Molecular Weight | 338.042 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 57.8±8.0 °C at 760 mmHg | |
| Molecular Formula | C6F14 | Melting Point | −4 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 1.2±10.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PerfluorohexanePerflexane was developed as an ultrasound (US) contrast agent for use in echocardiograms to enhance US images. |
| Name | perfluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 57.8±8.0 °C at 760 mmHg |
| Melting Point | −4 °C(lit.) |
| Molecular Formula | C6F14 |
| Molecular Weight | 338.042 |
| Flash Point | 1.2±10.2 °C |
| Exact Mass | 337.977631 |
| LogP | 5.65 |
| Vapour Pressure | 227.9±0.1 mmHg at 25°C |
| Index of Refraction | 1.248 |
| InChIKey | ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Stability | Stable. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | MO4310000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2901100000 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Factors affecting ultrasonic release from eLiposomes.
J. Pharm. Sci. 104(4) , 1373-84, (2015) Liposomes containing emulsion droplets (eLiposomes) were studied as ultrasound-responsive liposomal drug carriers. This paper presents the effects of temperature, eLiposome size, and ultrasound parame... |
|
|
Physiological features of Halomonas lionensis sp. nov., a novel bacterium isolated from a Mediterranean Sea sediment.
Res. Microbiol. 165(7) , 490-500, (2014) A novel halophilic bacterium, strain RHS90(T), was isolated from marine sediments from the Gulf of Lions, in the Mediterranean Sea. Its metabolic and physiological characteristics were examined under ... |
|
|
Cytosolic delivery via escape from the endosome using emulsion droplets and ultrasound.
J. Drug Target. 23 , 469-79, (2015) Vaporizing emulsion droplets may aid in endosomal rupture as a drug delivery route to the cytosol. Upon insonation, emulsion droplets formed from perfluorocarbon liquids may vaporize with sufficient e... |
| Tetradecafluorohexanes |
| EINECS 206-585-0 |
| Fluorinert PF 5060 |
| MFCD00000437 |
| Hexane, 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluoro- |
| Perfluorohexanes |
| Perfluoro-n-hexane |
| fluorinert fc-72 |
| Tetradecafluorohexane |
| Fluorinert FC 72 |
| hexane, tetradecafluoro- |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane |
| Flutec PP 1 |
| Hexane,tetradecafluoro |
| Perfluorohexane |
| PP 1 |
| perflexane |
| Flutec PP1 |
| Perfluoro-compound FC-72§3 |
| n-tetradecafluorohexane |