1h-6-bromoperfluorohexane structure
|
Common Name | 1h-6-bromoperfluorohexane | ||
|---|---|---|---|---|
| CAS Number | 355-36-2 | Molecular Weight | 380.95700 | |
| Density | 1.842g/cm3 | Boiling Point | 116.1ºC at 760mmHg | |
| Molecular Formula | C6HBrF12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 24ºC | |
| Name | 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.842g/cm3 |
|---|---|
| Boiling Point | 116.1ºC at 760mmHg |
| Molecular Formula | C6HBrF12 |
| Molecular Weight | 380.95700 |
| Flash Point | 24ºC |
| Exact Mass | 379.90700 |
| LogP | 4.78040 |
| Index of Refraction | 1.3115 |
| InChIKey | POJDLLAQCVDMMK-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
|
~%
Detail
|
| Literature: Haszeldine; Steele Journal of the Chemical Society, 1954 , p. 3747,3751 |
| 6H-perfluorohexyl bromide |
| MFCD00153081 |
| 6-H-perfluoro-1-bromohexane |
| PC1533 |
| 1H-6-Bromoperfluorohexane,tech. |