N'-(p-Acetylaminophenylsulfonyl)isonicotinic hydrazide
Modify Date: 2025-09-28 17:45:04
N'-(p-Acetylaminophenylsulfonyl)isonicotinic hydrazide structure
|
Common Name | N'-(p-Acetylaminophenylsulfonyl)isonicotinic hydrazide | ||
|---|---|---|---|---|
| CAS Number | 35285-73-5 | Molecular Weight | 334.35000 | |
| Density | 1.425g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[(pyridine-4-carbonylamino)sulfamoyl]phenyl]acetamide |
|---|
| Density | 1.425g/cm3 |
|---|---|
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.35000 |
| Exact Mass | 334.07400 |
| PSA | 129.13000 |
| LogP | 3.17540 |
| Index of Refraction | 1.627 |
| InChIKey | ZOUFUQZACIWGGV-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NNC(=O)c2ccncc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~%
N'-(p-Acetylami... CAS#:35285-73-5 |
| Literature: Osman; Abdalla; Alaib Journal of Pharmaceutical Sciences, 1983 , vol. 72, # 1 p. 68 - 71 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |