1-BENZYL-3-PHENYL-2-THIOUREA
Modify Date: 2025-08-27 15:17:57
1-BENZYL-3-PHENYL-2-THIOUREA structure
|
Common Name | 1-BENZYL-3-PHENYL-2-THIOUREA | ||
|---|---|---|---|---|
| CAS Number | 352535-74-1 | Molecular Weight | 271.37200 | |
| Density | 0.988g/cm3 | Boiling Point | 364.564ºC at 760 mmHg | |
| Molecular Formula | C18H22FN | Melting Point | 48-52ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 165.655ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2R)-1-fluoro-4-methyl-1,1-diphenylpentan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.988g/cm3 |
|---|---|
| Boiling Point | 364.564ºC at 760 mmHg |
| Melting Point | 48-52ºC(lit.) |
| Molecular Formula | C18H22FN |
| Molecular Weight | 271.37200 |
| Flash Point | 165.655ºC |
| Exact Mass | 271.17400 |
| PSA | 26.02000 |
| LogP | 4.97340 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | PDTGGQHFGXMDGP-QGZVFWFLSA-N |
| SMILES | CC(C)CC(N)C(F)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD03093534 |