1-(2,4-dihydroxyphenyl)-2-pyridin-1-yl-ethanone structure
|
Common Name | 1-(2,4-dihydroxyphenyl)-2-pyridin-1-yl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 35244-15-6 | Molecular Weight | 357.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4-dihydroxyphenyl)-2-pyridin-1-ium-1-ylethanone,iodide |
|---|
| Molecular Formula | C13H12INO3 |
|---|---|
| Molecular Weight | 357.14400 |
| Exact Mass | 356.98600 |
| PSA | 61.41000 |
| InChIKey | OMSBYQCPTIHTLD-UHFFFAOYSA-N |
| SMILES | O=C(C[n+]1ccccc1)c1ccc(O)cc1O.[I-] |
|
~%
1-(2,4-dihydrox... CAS#:35244-15-6 |
| Literature: King; McWhirter; Barton Journal of the American Chemical Society, 1945 , vol. 67, p. 2089,2090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |