3,4-epoxy-2-phenyl-1,1,1-trifluoro-2-butanol
Modify Date: 2024-01-03 05:52:16
3,4-epoxy-2-phenyl-1,1,1-trifluoro-2-butanol structure
|
Common Name | 3,4-epoxy-2-phenyl-1,1,1-trifluoro-2-butanol | ||
|---|---|---|---|---|
| CAS Number | 351003-37-7 | Molecular Weight | 218.17200 | |
| Density | 1.418g/cm3 | Boiling Point | 288.9ºC at 760mmHg | |
| Molecular Formula | C10H9F3O2 | Melting Point | 83-88ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 138.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,2,2-trifluoro-1-(oxiran-2-yl)-1-phenylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 288.9ºC at 760mmHg |
| Melting Point | 83-88ºC(lit.) |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17200 |
| Flash Point | 138.2ºC |
| Exact Mass | 218.05500 |
| PSA | 32.76000 |
| LogP | 1.83530 |
| Index of Refraction | 1.512 |
| InChIKey | ZVHBUEYSUVEOKE-UHFFFAOYSA-N |
| SMILES | OC(c1ccccc1)(C1CO1)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2910900090 |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3,4-Epoxy-2-phenyl-1,1,1-trifluoro-2-butanol |
| MFCD03427132 |