3-AMINO-2-(4-BROMOBENZOYL)-6-NITROBENZO& structure
|
Common Name | 3-AMINO-2-(4-BROMOBENZOYL)-6-NITROBENZO& | ||
|---|---|---|---|---|
| CAS Number | 351003-26-4 | Molecular Weight | 361.14700 | |
| Density | 1.681g/cm3 | Boiling Point | 568.9ºC at 760 mmHg | |
| Molecular Formula | C15H9BrN2O4 | Melting Point | 282ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 297.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (3-amino-6-nitro-1-benzofuran-2-yl)-(4-bromophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.681g/cm3 |
|---|---|
| Boiling Point | 568.9ºC at 760 mmHg |
| Melting Point | 282ºC (dec.)(lit.) |
| Molecular Formula | C15H9BrN2O4 |
| Molecular Weight | 361.14700 |
| Flash Point | 297.9ºC |
| Exact Mass | 359.97500 |
| PSA | 102.05000 |
| LogP | 5.02110 |
| Index of Refraction | 1.718 |
| InChIKey | RNOBWEKCGACXCG-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)c2ccc(Br)cc2)oc2cc([N+](=O)[O-])ccc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD03427109 |