2,5-bis(trifluoromethyl)benzenesulfonyl chloride structure
|
Common Name | 2,5-bis(trifluoromethyl)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 351003-22-0 | Molecular Weight | 312.61700 | |
| Density | 1.503g/cm3 | Boiling Point | 310ºC at 760mmHg | |
| Molecular Formula | C8H3ClF6O2S | Melting Point | 59-63 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 141.3ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2,5-bis(trifluoromethyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 310ºC at 760mmHg |
| Melting Point | 59-63 °C(lit.) |
| Molecular Formula | C8H3ClF6O2S |
| Molecular Weight | 312.61700 |
| Flash Point | 141.3ºC |
| Exact Mass | 311.94500 |
| PSA | 42.52000 |
| LogP | 4.73250 |
| Index of Refraction | 1.494 |
| InChIKey | KMEJLLXSUGLEDJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,5-Bis(trifluoromethyl)benzene-1-sulfonyl chloride |
| MFCD03094042 |
| 2,5-Bis(trifluoromethyl)benzenesulfonyl chloride |