4-Butoxy-3-nitrobenzaldehyde structure
|
Common Name | 4-Butoxy-3-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 351002-94-3 | Molecular Weight | 223.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Butoxy-3-nitrobenzaldehyde |
|---|
| Molecular Formula | C11H13NO4 |
|---|---|
| Molecular Weight | 223.22500 |
| Exact Mass | 223.08400 |
| PSA | 72.12000 |
| LogP | 3.10940 |
| InChIKey | XWQYYXDQELBGLI-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C=O)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR | NONH for all modes of transport |
| HS Code | 2913000090 |
|
~91%
4-Butoxy-3-nitr... CAS#:351002-94-3 |
| Literature: Zhu, Yuan-Yuan; Wang, Gui-Tao; Li, Zhan-Ting Organic and Biomolecular Chemistry, 2009 , vol. 7, # 16 p. 3243 - 3250 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |