L-Carnitine-d3 (chloride)
Modify Date: 2025-08-21 21:41:21
L-Carnitine-d3 (chloride) structure
|
Common Name | L-Carnitine-d3 (chloride) | ||
|---|---|---|---|---|
| CAS Number | 350818-62-1 | Molecular Weight | 186.65200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11ClD3NO3 | Melting Point | 131-135°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [(2R)-3-carboxy-2-hydroxypropyl]-dimethyl-(trideuteriomethyl)azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 131-135°C |
|---|---|
| Molecular Formula | C6H11ClD3NO3 |
| Molecular Weight | 186.65200 |
| Exact Mass | 186.08500 |
| PSA | 60.77000 |
| LogP | 0.18560 |
| InChIKey | JXXCENBLGFBQJM-QKBJTWEASA-N |
| SMILES | C[N+](C)(C)CC(O)CC(=O)O.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
|
Effect of a negative energy balance induced by feed restriction in lactating sows on hepatic lipid metabolism, milk production and development of litters.
Arch. Anim. Nutr. 69 , 399-410, (2015) In rodents, forced activation of hepatic peroxisome proliferator-activated receptor α (PPARα) by administration of exogenous PPARα activators during lactation leads to a reduction of milk triacylglyce... |
| L-Carnitine-methyl-d3 hydrochloride |