N,N-bis(2,2,2-trinitroethyl)nitrous amide structure
|
Common Name | N,N-bis(2,2,2-trinitroethyl)nitrous amide | ||
|---|---|---|---|---|
| CAS Number | 34882-73-0 | Molecular Weight | 372.12000 | |
| Density | 2.43g/cm3 | Boiling Point | 482ºC at 760mmHg | |
| Molecular Formula | C4H4N8O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Name | N,N-bis(2,2,2-trinitroethyl)nitrous amide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.43g/cm3 |
|---|---|
| Boiling Point | 482ºC at 760mmHg |
| Molecular Formula | C4H4N8O13 |
| Molecular Weight | 372.12000 |
| Flash Point | 245.3ºC |
| Exact Mass | 371.99000 |
| PSA | 307.59000 |
| LogP | 1.07680 |
| InChIKey | CPGUZLYQVSEGDZ-UHFFFAOYSA-N |
| SMILES | O=NN(CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])CC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
|
~%
N,N-bis(2,2,2-t... CAS#:34882-73-0 |
| Literature: Gafurov,R.G. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1971 , vol. 20, p. 2480 - 2482 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1971 , vol. 20, p. 2606 - 2608 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| N-Nitrosobis-(2,2,2-trinitroethyl)amine |
| bis(2,2,2-trinitroethyl)-N-nitrosoamine |
| Bis-2,2,2-trinitroethyl-nitrosamin |
| 1,1,1,3,5,5,5-Hexanitro-3-nitroso-3-azapentan |
| Bis-(2,2,2-trinitroethyl)-N-nitrosamin |