Bis(2,2,2-trinitroethyl)amine
Modify Date: 2025-08-21 11:50:55
Bis(2,2,2-trinitroethyl)amine structure
|
Common Name | Bis(2,2,2-trinitroethyl)amine | ||
|---|---|---|---|---|
| CAS Number | 34880-53-0 | Molecular Weight | 343.12200 | |
| Density | 1.904g/cm3 | Boiling Point | 416.9ºC at 760 mmHg | |
| Molecular Formula | C4H5N7O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | 2,2,2-trinitro-N-(2,2,2-trinitroethyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.904g/cm3 |
|---|---|
| Boiling Point | 416.9ºC at 760 mmHg |
| Molecular Formula | C4H5N7O12 |
| Molecular Weight | 343.12200 |
| Flash Point | 206ºC |
| Exact Mass | 343.00000 |
| PSA | 286.95000 |
| LogP | 1.07390 |
| Index of Refraction | 1.583 |
| InChIKey | HCQOJHQSPRZMIO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(CNCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
|
~%
Bis(2,2,2-trini... CAS#:34880-53-0 |
| Literature: Ungnade,H.E.; Kissinger,L.W. Journal of Organic Chemistry, 1965 , vol. 30, p. 354 - 359 |
|
~29%
Bis(2,2,2-trini... CAS#:34880-53-0 |
| Literature: Fedorov Russian Chemical Bulletin, 1996 , vol. 45, # 3 p. 722 - 723 |
|
~%
Bis(2,2,2-trini... CAS#:34880-53-0 |
| Literature: Nitroglycerin A.B. Patent: US2731460 , 1952 ; |
| 1,1,1,5,5,5-hexanitro-3-azapentane |
| bis-(2,2,2-trinitro-ethyl)-amine |
| Bis-<2,2,2-trinitro-ethyl>-amin |
| Bis-(2,2,2-trinitro-aethyl)-amin |