1-METHYL-5-NITRO-ISATIN
Modify Date: 2025-08-21 06:35:46
1-METHYL-5-NITRO-ISATIN structure
|
Common Name | 1-METHYL-5-NITRO-ISATIN | ||
|---|---|---|---|---|
| CAS Number | 3484-32-0 | Molecular Weight | 206.15500 | |
| Density | 1.533g/cm3 | Boiling Point | 391.9ºC at 760 mmHg | |
| Molecular Formula | C9H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.8ºC | |
| Name | 1-methyl-5-nitroindole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 391.9ºC at 760 mmHg |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.15500 |
| Flash Point | 190.8ºC |
| Exact Mass | 206.03300 |
| PSA | 83.20000 |
| LogP | 1.34210 |
| Index of Refraction | 1.647 |
| InChIKey | JPTDPTOWOMFBRY-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=O)c2cc([N+](=O)[O-])ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-1-methylisatin |
| 1-methyl-5-nitro-indole-2,3-dione |
| N-methyl-5-nitroisatin |
| 1-methyl-5-nitro-isatin |
| Isatin analog 1 |
| 1-methyl-5-nitroindoline-2,3-dione |
| 5-nitro-N-methylisatin |
| 5-nitro-1-methyl-indole-2,3-dione |
| 1-N-methyl-5-nitroisatin |