2-(methylsulfanylmethyl)-4-nitro-aniline structure
|
Common Name | 2-(methylsulfanylmethyl)-4-nitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 34774-93-1 | Molecular Weight | 198.24200 | |
| Density | 1.318g/cm3 | Boiling Point | 407.2ºC at 760 mmHg | |
| Molecular Formula | C8H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.1ºC | |
| Name | 2-(methylsulfanylmethyl)-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 407.2ºC at 760 mmHg |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.24200 |
| Flash Point | 200.1ºC |
| Exact Mass | 198.04600 |
| PSA | 97.14000 |
| LogP | 3.14440 |
| Index of Refraction | 1.646 |
| InChIKey | HCRSXTSGSLECNB-UHFFFAOYSA-N |
| SMILES | CSCc1cc([N+](=O)[O-])ccc1N |
|
~38%
2-(methylsulfan... CAS#:34774-93-1
Detail
|
| Literature: Benati, Luisa; Montevecchi, P. Carlo; Spagnolo, Piero Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 4 p. 625 - 627 |
|
~%
2-(methylsulfan... CAS#:34774-93-1 |
| Literature: Hiraki,Y. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 447 - 452 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-2-(thiomethoxymethyl)-anilin |
| 4-Nitro-2-methylthiomethyl-anilin |
| 2-Amino-5-nitrobenzylmethylsulfid |
| 2-methylsulfanylmethyl-4-nitro-aniline |