4-nitro-benzoic acid-(4-fluoro-phenyl ester)
Modify Date: 2025-09-12 14:52:21
4-nitro-benzoic acid-(4-fluoro-phenyl ester) structure
|
Common Name | 4-nitro-benzoic acid-(4-fluoro-phenyl ester) | ||
|---|---|---|---|---|
| CAS Number | 347-82-0 | Molecular Weight | 261.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-benzoic acid-(4-fluoro-phenyl ester) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8FNO4 |
|---|---|
| Molecular Weight | 261.20500 |
| Exact Mass | 261.04400 |
| PSA | 72.12000 |
| LogP | 3.47630 |
| InChIKey | ZXPHTVYWTQJABV-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(F)cc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
|
~%
4-nitro-benzoic... CAS#:347-82-0 |
| Literature: Conte, L.; Napoli, M.; Gambaretto, J. P.; Guerrato, A.; Carlini, F. M. Journal of Fluorine Chemistry, 1994 , vol. 67, # 1 p. 41 - 46 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:371-41-5
CAS#:62-23-7| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Nitro-benzoesaeure-(4-fluor-phenylester) |
| 4-Fluorphenyl-p-nitrobenzoat |
| 4'-Fluorphenyl-4-nitrobenzoat |