1,4-Benzenediol,1-(4-nitrobenzoate)
Modify Date: 2025-12-08 21:50:43
1,4-Benzenediol,1-(4-nitrobenzoate) structure
|
Common Name | 1,4-Benzenediol,1-(4-nitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 13245-55-1 | Molecular Weight | 259.21400 | |
| Density | 1.415g/cm3 | Boiling Point | 477.6ºC at 760mmHg | |
| Molecular Formula | C13H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.7ºC | |
| Name | (4-hydroxyphenyl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 477.6ºC at 760mmHg |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.21400 |
| Flash Point | 242.7ºC |
| Exact Mass | 259.04800 |
| PSA | 92.35000 |
| LogP | 3.04280 |
| Vapour Pressure | 9.55E-10mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | OOKOBCBLUCPMQB-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(O)cc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-HYDROXYPHENYL 4-NITROBENZOATE |
| 4-hydroxyphenyl-4-nitrobenzoat |
| 4-nitro-benzoic acid-(4-hydroxy-phenyl ester) |
| p-Hydroxyphenyl-p-nitrobenzoat |
| 4-Nitro-benzoesaeure-(4-hydroxy-phenylester) |