(4-cyclohexylphenyl) pyridine-3-carboxylate
Modify Date: 2025-09-18 09:26:01
(4-cyclohexylphenyl) pyridine-3-carboxylate structure
|
Common Name | (4-cyclohexylphenyl) pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 3468-32-4 | Molecular Weight | 281.34900 | |
| Density | 1.137g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C18H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | (4-cyclohexylphenyl) pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.34900 |
| Flash Point | 215.3ºC |
| Exact Mass | 281.14200 |
| PSA | 39.19000 |
| LogP | 4.34850 |
| Index of Refraction | 1.576 |
| InChIKey | WZPVEPWPLQMODU-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(C2CCCCC2)cc1)c1cccnc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-cyclohexylphenyl nicotinate |
| 1-Cyclohexyl-4-nicotinoyloxy-benzol |
| 3-Pyridinecarboxylic acid,4-cyclohexylphenyl ester |
| 4-Cyclohexylphenyl nicotinate |
| 4-Cyclohexylphenyl 3-pyridinecarboxylate |