2-tert-butyl-4-cyclohexylphenyl nicotinate
Modify Date: 2025-10-17 16:23:05
2-tert-butyl-4-cyclohexylphenyl nicotinate structure
|
Common Name | 2-tert-butyl-4-cyclohexylphenyl nicotinate | ||
|---|---|---|---|---|
| CAS Number | 79781-87-6 | Molecular Weight | 337.45500 | |
| Density | 1.074g/cm3 | Boiling Point | 482.7ºC at 760 mmHg | |
| Molecular Formula | C22H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.7ºC | |
| Name | (2-tert-butyl-4-cyclohexylphenyl) pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 482.7ºC at 760 mmHg |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.45500 |
| Flash Point | 245.7ºC |
| Exact Mass | 337.20400 |
| PSA | 39.19000 |
| LogP | 5.64600 |
| Index of Refraction | 1.551 |
| InChIKey | IKARRQFFZRTPEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C2CCCCC2)ccc1OC(=O)c1cccnc1 |
| 2-tert-Butyl-4-cyclohexylphenyl nicotinate |
| 3-Pyridinecarboxylic acid,4-cyclohexyl-2-(1,1-dimethylethyl)phenyl ester |
| 4-Cyclohexyl-2-(1,1-dimethylethyl)phenyl 3-pyridinecarboxylate |
| 2-tert-Butyl-4-cyclohexylphenyl ester of nicotinic acid |
| EINECS 279-260-4 |
| 2-t-Butyl-4-cyclohexylphenyl nicotinate |