2-hydroxyl emodin-1-methyl ether structure
|
Common Name | 2-hydroxyl emodin-1-methyl ether | ||
|---|---|---|---|---|
| CAS Number | 346434-45-5 | Molecular Weight | 300.26 | |
| Density | 1.542±0.06 g/cm3(Predicted) | Boiling Point | 619.7±55.0 °C(Predicted) | |
| Molecular Formula | C16H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-hydroxyl emodin-1-methyl ether2-Hydroxyl emodin-1-methyl ether (Compound 5) is an anthraquinone that can be isolated from the seeds of Cassia obtusifolia[1]. |
| Name | 2-hydroxyl emodin-1-methyl ether |
|---|
| Description | 2-Hydroxyl emodin-1-methyl ether (Compound 5) is an anthraquinone that can be isolated from the seeds of Cassia obtusifolia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.542±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 619.7±55.0 °C(Predicted) |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26 |
| InChIKey | JGWNHIDADWFGIJ-UHFFFAOYSA-N |
| SMILES | COc1c(O)c(C)cc2c1C(=O)c1c(O)cc(O)cc1C2=O |