Phenol,2,6-dichloro-4-(1,1-dimethylethyl)- structure
|
Common Name | Phenol,2,6-dichloro-4-(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 34593-75-4 | Molecular Weight | 219.10800 | |
| Density | 1.227g/cm3 | Boiling Point | 243.8ºC at 760mmHg | |
| Molecular Formula | C10H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.2ºC | |
| Name | 4-tert-butyl-2,6-dichlorophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 243.8ºC at 760mmHg |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.10800 |
| Flash Point | 108.2ºC |
| Exact Mass | 218.02700 |
| PSA | 20.23000 |
| LogP | 3.99650 |
| Index of Refraction | 1.543 |
| InChIKey | RETRALMQVUXTPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cl)c(O)c(Cl)c1 |
| HS Code | 2908199090 |
|---|
|
~%
Phenol,2,6-dich... CAS#:34593-75-4 |
| Literature: May + Baker Ltd Patent: FR2298950DE2603864 , 19761976 ; Chem.Abstr., 1977 , vol. 86, # 29436 |
|
~%
Phenol,2,6-dich... CAS#:34593-75-4 |
| Literature: Tashiro, Masashi; Itoh, Takashi; Fukata, Gouki Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 2 p. 416 - 420 |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,6-dichloro-4-t-butylphenol |
| 4-tert-Butyl-2,6-dichlor-phenol |
| 4-tert-butyl-2,6-dichloro-phenol |
| 2,6-Dichlor-4-tert.-butylphenol |
| 2,6-Dichloro-4-(1,1-dimethylethyl)phenol |