(5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid
Modify Date: 2025-09-22 11:31:56
(5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid structure
|
Common Name | (5-Methyl-3-trifluoromethylpyrazol-1-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 345637-71-0 | Molecular Weight | 208.13800 | |
| Density | 1.48g/cm3 | Boiling Point | 292.5ºC at 760 mmHg | |
| Molecular Formula | C7H7F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.7ºC | |
| Name | 2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 292.5ºC at 760 mmHg |
| Molecular Formula | C7H7F3N2O2 |
| Molecular Weight | 208.13800 |
| Flash Point | 130.7ºC |
| Exact Mass | 208.04600 |
| PSA | 55.12000 |
| LogP | 1.29490 |
| Index of Refraction | 1.496 |
| InChIKey | RBHQAIFXLJIFFM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~%
(5-Methyl-3-tri... CAS#:345637-71-0 |
| Literature: WO2008/91580 A2, ; Page/Page column 53 ; |
|
~%
(5-Methyl-3-tri... CAS#:345637-71-0 |
| Literature: WO2007/14290 A2, ; Page/Page column 55-56 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00297315 |