2H-1,2,4-Benzothiadiazine, 6,7-dichloro-3,4-dihydro-2-hydroxy-3-(4-nitrophenyl)-, 1,1-dioxide structure
|
Common Name | 2H-1,2,4-Benzothiadiazine, 6,7-dichloro-3,4-dihydro-2-hydroxy-3-(4-nitrophenyl)-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 34522-68-4 | Molecular Weight | 390.19900 | |
| Density | 1.72g/cm3 | Boiling Point | 635ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.8ºC | |
| Name | 6,7-dichloro-2-hydroxy-3-(4-nitrophenyl)-3,4-dihydro-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 635ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2N3O5S |
| Molecular Weight | 390.19900 |
| Flash Point | 337.8ºC |
| Exact Mass | 388.96400 |
| PSA | 123.84000 |
| LogP | 5.08570 |
| Index of Refraction | 1.699 |
| InChIKey | XZZKFXGPAMRYOJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C2Nc3cc(Cl)c(Cl)cc3S(=O)(=O)N2O)cc1 |
|
~%
2H-1,2,4-Benzot... CAS#:34522-68-4 |
| Literature: Heindel,N.D. et al. Journal of Medicinal Chemistry, 1972 , vol. 15, p. 118 - 120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |