N,N'-diacetyladipohydrazide structure
|
Common Name | N,N'-diacetyladipohydrazide | ||
|---|---|---|---|---|
| CAS Number | 34375-39-8 | Molecular Weight | 258.27400 | |
| Density | 1.188g/cm3 | Boiling Point | 652.3ºC at 760mmHg | |
| Molecular Formula | C10H18N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.3ºC | |
| Name | 1-N',6-N'-diacetylhexanedihydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 652.3ºC at 760mmHg |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.27400 |
| Flash Point | 273.3ºC |
| Exact Mass | 258.13300 |
| PSA | 130.36000 |
| LogP | 2.24260 |
| Index of Refraction | 1.509 |
| InChIKey | HQUUVVMNROIQPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NNC(=O)CCCCC(=O)NNC(C)=O |
| HS Code | 2928000090 |
|---|
|
~%
N,N'-diacetylad... CAS#:34375-39-8 |
| Literature: Al-Talib, Mahmoud; Tashtoush, Hasan; Odeh, Nedal Magnetic Resonance in Chemistry, 1990 , vol. 28, # 12 p. 1072 - 1075 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N'1,N'6-diacetylhexanedihydrazide |
| N,N'-diacetyladipoyl dihydrazide |
| EINECS 251-975-6 |
| N,N'-Diacetyladipohydrazide |