4-(TERT-BUTOXYMETHYL)BENZOIC ACID structure
|
Common Name | 4-(TERT-BUTOXYMETHYL)BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 34224-31-2 | Molecular Weight | 208.25400 | |
| Density | 1.091g/cm3 | Boiling Point | 313ºC at 760 mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | 147-151ºC | |
| MSDS | Chinese USA | Flash Point | 114.9ºC | |
| Name | 4-[(2-methylpropan-2-yl)oxymethyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 313ºC at 760 mmHg |
| Melting Point | 147-151ºC |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Flash Point | 114.9ºC |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.69990 |
| Index of Refraction | 1.523 |
| InChIKey | HXNWRKOKHLXUQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OCc1ccc(C(=O)O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
|
~88%
4-(TERT-BUTOXYM... CAS#:34224-31-2 |
| Literature: Han; Janda Journal of the American Chemical Society, 1996 , vol. 118, # 11 p. 2539 - 2544 |
|
~%
4-(TERT-BUTOXYM... CAS#:34224-31-2 |
| Literature: Han; Janda Journal of the American Chemical Society, 1996 , vol. 118, # 11 p. 2539 - 2544 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
H. Han, K.D. Janda
J. Am. Chem. Soc. 118 , 2540, (1996)
|
| p-O-tert-butyl(hydroxymethyl)benzoic acid |
| 4-(tert-Butoxymethyl)benzoic acid |
| p-(tert-Butoxymethyl)benzoic-acid |