1,1-(9H-carbazole-3,6-diyl)diethanone
Modify Date: 2025-09-18 09:33:30
1,1-(9H-carbazole-3,6-diyl)diethanone structure
|
Common Name | 1,1-(9H-carbazole-3,6-diyl)diethanone | ||
|---|---|---|---|---|
| CAS Number | 3403-70-1 | Molecular Weight | 251.28000 | |
| Density | 1.262g/cm3 | Boiling Point | 484.7ºC at 760 mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
| Name | 3,6-diacetylcarbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 484.7ºC at 760 mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 244.4ºC |
| Exact Mass | 251.09500 |
| PSA | 49.93000 |
| LogP | 3.72630 |
| Index of Refraction | 1.694 |
| InChIKey | PQLQXNVTTJCZFJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2[nH]c3ccc(C(C)=O)cc3c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-butylidenebis-cyclohexane |
| 3,6-Diacetyl-carbazol |
| Cyclohexane,1,1'-butylidenebis |
| 3,6-diacetyl-carbazole |
| 1,1'-butane-1,1-diyldicyclohexane |
| 1,1-Dicyclohexylbutane |
| 1,1'-carbazole-3,6-diyl-bis-ethanone |