4-(Trimethoxysilyl)aniline structure
|
Common Name | 4-(Trimethoxysilyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 33976-43-1 | Molecular Weight | 213.306 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 241.2±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H15NO3Si | Melting Point | 60-62ºC | |
| MSDS | N/A | Flash Point | 99.7±22.6 °C | |
| Name | m-aminophenyltrimethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 241.2±23.0 °C at 760 mmHg |
| Melting Point | 60-62ºC |
| Molecular Formula | C9H15NO3Si |
| Molecular Weight | 213.306 |
| Flash Point | 99.7±22.6 °C |
| Exact Mass | 213.082123 |
| PSA | 53.71000 |
| LogP | 0.11 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | CNODSORTHKVDEM-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)c1ccc(N)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzenamine, 4-(trimethoxysilyl)- |
| 4-aminophenyltrimethoxysilane |
| para-aminophenyltrimethoxysilane |
| 4-trifluoromethanesulfinyl-aniline |
| Benzenamine,4-[(trifluoromethyl)sulfinyl] |
| 4-(Trimethoxysilyl)aniline |
| (4-Acetamino-phenyl)-trifluormethyl-sulfoxid |
| 4-aminophenyl trifluoromethylsulfoxide |
| 1,4-aminophenyltrimethoxysilane |
| p-Aminophenyl-trifluormethyl-sulfoxid |
| 4-anilinotrimethoxysilane |
| Trifluormethyl-(4-amino-phenyl)-sulfoxid |