4'-nitrobenzanilide structure
|
Common Name | 4'-nitrobenzanilide | ||
|---|---|---|---|---|
| CAS Number | 3393-96-2 | Molecular Weight | 242.23000 | |
| Density | 1.344g/cm3 | Boiling Point | 327ºC at 760mmHg | |
| Molecular Formula | C13H10N2O3 | Melting Point | 202-204°C | |
| MSDS | N/A | Flash Point | 151.5ºC | |
| Name | N-(4-nitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 327ºC at 760mmHg |
| Melting Point | 202-204°C |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23000 |
| Flash Point | 151.5ºC |
| Exact Mass | 242.06900 |
| PSA | 74.92000 |
| LogP | 3.44330 |
| Index of Refraction | 1.671 |
| InChIKey | GMGQGZYFQSCZCW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p'-Nitrobenzanilide |
| N-(4-Nitrophenyl)benzamide |
| Benzanilide,4'-nitro |
| MFCD00024619 |
| N-Benzoyl-p-nitroaniline |
| 4-nitro-N-benzoylaniline |
| 4-benzamidonitrobenzene |
| 4'-NITROBENZANILIDE |
| EINECS 222-241-2 |