Guanosine,6-S-(1-methyl-4-nitro-1H-imidazol-5-yl)-6-thio- (9CI)
Modify Date: 2025-08-22 18:45:15
Guanosine,6-S-(1-methyl-4-nitro-1H-imidazol-5-yl)-6-thio- (9CI) structure
|
Common Name | Guanosine,6-S-(1-methyl-4-nitro-1H-imidazol-5-yl)-6-thio- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3384-61-0 | Molecular Weight | 424.39200 | |
| Density | 2.13g/cm3 | Boiling Point | 907.8ºC at 760mmHg | |
| Molecular Formula | C14H16N8O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 502.8ºC | |
| Name | 9H-Purine, 2-amino-6-(1-methyl-4-nitroimidazol-5-ylthio)-9-.β.-D-ribofuranosyl |
|---|
| Density | 2.13g/cm3 |
|---|---|
| Boiling Point | 907.8ºC at 760mmHg |
| Molecular Formula | C14H16N8O6S |
| Molecular Weight | 424.39200 |
| Flash Point | 502.8ºC |
| Exact Mass | 424.09100 |
| PSA | 228.48000 |
| Index of Refraction | 1.955 |
| InChIKey | WJPLSTABBCGIQS-GVTXSBRZSA-N |
| SMILES | Cn1cnc([N+](=O)[O-])c1Sc1nc(N)nc2c1ncn2C1OC(CO)C(O)C1O |
|
~58%
Guanosine,6-S-(... CAS#:3384-61-0 |
| Literature: Krenitsky, Thomas A.; Hall, Willard W.; Selph, Jeffrey L.; Truax, James F.; Vinegar, Ralph Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1471 - 1475 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |