1,4-Dibenzoylbutane structure
|
Common Name | 1,4-Dibenzoylbutane | ||
|---|---|---|---|---|
| CAS Number | 3375-38-0 | Molecular Weight | 266.33400 | |
| Density | 1.08g/cm3 | Boiling Point | 433.5ºC at 760mmHg | |
| Molecular Formula | C18H18O2 | Melting Point | 106-108 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 161.9ºC | |
Use of 1,4-DibenzoylbutaneSolubility in hot Toluene:almost transparency |
| Name | 1,6-diphenylhexane-1,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760mmHg |
| Melting Point | 106-108 °C(lit.) |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.33400 |
| Flash Point | 161.9ºC |
| Exact Mass | 266.13100 |
| PSA | 34.14000 |
| LogP | 4.31260 |
| Index of Refraction | 1.56 |
| InChIKey | VRBLNWVVFVBNRK-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)c1ccccc1)c1ccccc1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,6-diphenyl-hexane-1,6-dione |
| 1,6-diphenyl-1,6-hexadione |
| 1,6-Hexanedione,1,6-diphenyl |
| 1,6-Diphenyl-hexan-1,6-dion |
| 1,4-dibenzoylbutane |
| Butane,1,4-dibenzoyl |
| EINECS 222-166-5 |
| Butane,4-dibenzoyl |
| 1,6-diphenyl-1,6-hexanedione |
| MFCD00004761 |
| 1,6-hexanedione |