3,5-Difluoro-4-[difluoro(3,4,5-trifluorophenoxy)methyl]-4'-propyl-1,1'-biphenyl
Modify Date: 2025-09-15 16:28:48
![3,5-Difluoro-4-[difluoro(3,4,5-trifluorophenoxy)methyl]-4'-propyl-1,1'-biphenyl Structure](https://image.chemsrc.com/caspic/312/337456-92-5.png)
3,5-Difluoro-4-[difluoro(3,4,5-trifluorophenoxy)methyl]-4'-propyl-1,1'-biphenyl structure
|
Common Name | 3,5-Difluoro-4-[difluoro(3,4,5-trifluorophenoxy)methyl]-4'-propyl-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 337456-92-5 | Molecular Weight | 392.362 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 425.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H17F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1±24.6 °C | |
| Name | 5-[difluoro-[4-(4-propylphenyl)phenyl]methoxy]-1,2,3-trifluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 425.4±45.0 °C at 760 mmHg |
| Molecular Formula | C22H17F5O |
| Molecular Weight | 392.362 |
| Flash Point | 220.1±24.6 °C |
| Exact Mass | 392.119965 |
| PSA | 9.23000 |
| LogP | 8.34 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | WMZJNUIUWYHJRV-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(-c2ccc(C(F)(F)Oc3cc(F)c(F)c(F)c3)cc2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Biphenyl,4-[difluoro(3,4,5-trifluorophenoxy)methyl]-4'-propyl |
| 4-(Difluoro(3,4,5-trifluorophenoxy)methyl)-4'-propyl-1,1'-biphenyl |
| 4-[Difluoro(3,4,5-trifluorophenoxy)methyl]-4'-propylbiphenyl |
| Benzene, 5-[difluoro(4'-propyl[1,1'-biphenyl]-4-yl)methoxy]-1,2,3-trifluoro- |