Desoxyrhapontigenin structure
|
Common Name | Desoxyrhapontigenin | ||
|---|---|---|---|---|
| CAS Number | 33626-08-3 | Molecular Weight | 242.270 | |
| Density | 1.252 | Boiling Point | 446.5±14.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8±20.1 °C | |
Use of Desoxyrhapontigenin4'-Methoxyresveratrol (4'-O-Methylresveratrol) is a polyphenol derived from Dipterocarpaceae, with antiandrogenic, antifungal and anti-inflammatory activities. 4'-Methoxyresveratrol alleviates AGE-induced inflammation through suppressing RAGE-mediated MAPK/NF-κB signaling pathway and NLRP3 inflammasome activation[1]. |
| Name | 4'-Methoxyresveratrol |
|---|---|
| Synonym | More Synonyms |
| Description | 4'-Methoxyresveratrol (4'-O-Methylresveratrol) is a polyphenol derived from Dipterocarpaceae, with antiandrogenic, antifungal and anti-inflammatory activities. 4'-Methoxyresveratrol alleviates AGE-induced inflammation through suppressing RAGE-mediated MAPK/NF-κB signaling pathway and NLRP3 inflammasome activation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.252 |
|---|---|
| Boiling Point | 446.5±14.0 °C at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 223.8±20.1 °C |
| Exact Mass | 242.094299 |
| PSA | 49.69000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | IHVRWFJGOIWMGC-NSCUHMNNSA-N |
| SMILES | COc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| trans-3,5-dihydroxy-4'-methoxystlibene |
| 3,5-dihydroxy-4'-methoxy-trans-stilbene |
| 3,4-methylenedioxybenzaldehyde oxime |
| (E)-3,4-Methylenedioxybenzaldoxime |
| 4-Methoxyresveratrol |
| (E)-5-(4-methoxystyryl)benzene-1,3-diol |
| Oxirane,2,3-diethyl |
| 1,3-Benzenediol, 5-[(E)-2-(4-methoxyphenyl)ethenyl]- |
| (E)-3,4-epoxyhexane |
| trans-3,5-dihydroxy-4'-methoxystilbene |
| 1,3-benzenediol-5-[(E)-2-(4-methoxyphenyl)ethenyl] |
| 3,4-(methylenedioxy)benzaldoxime |
| trans-3,4-Epoxyhexane |
| (E)-piperonal oxime |
| E-oxime du piperonal |
| 5-[(E)-2-(4-Methoxyphenyl)vinyl]benzene-1,3-diol |
| 3,4-Epoxyhexane |
| (E)-3,5-dihydroxy-4'-methoxystlibene |
| 5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene-1,3-diol |
| Hexane,3,4-epoxy |
| resveratrol-4'-methyl ether |
| 2,3-diethyl-oxirane |
| 5-[(E)-2-(4-Methoxyphenyl)vinyl]-1,3-benzenediol |
| (E)-1-(1,3-benzodioxol-5-yl)-N-hydroxymethanimine |
| (E)-3,4-methylenedioxybenzaldehyde oxime |