3-BROMO-4-(4'-CHLOROPHENYL)PYRIDINE structure
|
Common Name | 3-BROMO-4-(4'-CHLOROPHENYL)PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 335642-99-4 | Molecular Weight | 268.53700 | |
| Density | 1.525g/cm3 | Boiling Point | 321.6ºC at 760mmHg | |
| Molecular Formula | C11H7BrClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.3ºC | |
| Name | 3-bromo-4-(4-chlorophenyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 321.6ºC at 760mmHg |
| Molecular Formula | C11H7BrClN |
| Molecular Weight | 268.53700 |
| Flash Point | 148.3ºC |
| Exact Mass | 266.94500 |
| PSA | 12.89000 |
| LogP | 4.16450 |
| Index of Refraction | 1.616 |
| InChIKey | JERVDTADAZZTBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=NC=C2)Br)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| or8274 |