1,1,1,2,2-Pentamethyl-2-(pentafluorophenyl)disilane structure
|
Common Name | 1,1,1,2,2-Pentamethyl-2-(pentafluorophenyl)disilane | ||
|---|---|---|---|---|
| CAS Number | 33558-55-3 | Molecular Weight | 298.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15F5Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (pentafluoro phenyl) pentamethyl disilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15F5Si2 |
|---|---|
| Molecular Weight | 298.40000 |
| Exact Mass | 298.06300 |
| LogP | 3.71410 |
| InChIKey | VLHPFXRGEXMOJE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (pentafluorophenyl)pentamethyldisilane |
| pentafluorofenylpentamethyldisilane |
| Pentafluorphenylpentamethyldisilan |
| pentamethylpentafluorophenyldisilane |