Trimethylsilylpentafluorobenzene structure
|
Common Name | Trimethylsilylpentafluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 1206-46-8 | Molecular Weight | 240.245 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 129.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H9F5Si | Melting Point | -50℃ | |
| MSDS | N/A | Flash Point | 32.1±27.3 °C | |
| Name | trimethyl(pentafluorophenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 129.5±40.0 °C at 760 mmHg |
| Melting Point | -50℃ |
| Molecular Formula | C9H9F5Si |
| Molecular Weight | 240.245 |
| Flash Point | 32.1±27.3 °C |
| Exact Mass | 240.039368 |
| LogP | 4.90 |
| Vapour Pressure | 12.4±0.2 mmHg at 25°C |
| Index of Refraction | 1.417 |
| InChIKey | GABHTFORECKGBB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| Storage condition | Flammables area |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzene, 1,2,3,4,5-pentafluoro-6-(trimethylsilyl)- |
| MFCD00092630 |
| Trimethyl(perfluorophenyl)silane |
| trimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| Trimethylsilylpentafluorobenzene |
| Trimethyl(pentafluorophenyl)silane |