3-[(4-chlorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione structure
|
Common Name | 3-[(4-chlorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione | ||
|---|---|---|---|---|
| CAS Number | 335215-60-6 | Molecular Weight | 269.75000 | |
| Density | 1.37g/cm3 | Boiling Point | 368.7ºC at 760 mmHg | |
| Molecular Formula | C11H12ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.8ºC | |
| Name | 3-[(4-chlorophenoxy)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 368.7ºC at 760 mmHg |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.75000 |
| Flash Point | 176.8ºC |
| Exact Mass | 269.03900 |
| PSA | 78.74000 |
| LogP | 2.81910 |
| Index of Refraction | 1.645 |
| InChIKey | STSBDYRUSUGXLS-UHFFFAOYSA-N |
| SMILES | CCn1c(COc2ccc(Cl)cc2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |