z-dab(boc)-oh structure
|
Common Name | z-dab(boc)-oh | ||
|---|---|---|---|---|
| CAS Number | 3350-13-8 | Molecular Weight | 533.700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H47N3O6 | Melting Point | 198-200℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-cyclohexylcyclohexanamine,(2S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 198-200℃ |
|---|---|
| Molecular Formula | C29H47N3O6 |
| Molecular Weight | 533.700 |
| Exact Mass | 533.346497 |
| PSA | 125.99000 |
| LogP | 6.69490 |
| Appearance of Characters | Powder | Off-white |
| InChIKey | CYMIEBREXUYHGN-ZOWNYOTGSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NCCC(NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | Store at RT. |
| Water Solubility | Slightly soluble in water. |
| Hazard Codes | Xi |
|---|
| Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-[[(phenylmethoxy)carbonyl]amino]-, (2S)-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| I04-1238 |
| N-Cbz-N'-Boc-L-2,4-Diaminobutyric acid dicyclohexylamine salt |
| Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid - N-cyclohexylcyclohexanamine (1:1) |
| Butanoic acid,4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-[[(phenylmethoxy)carbonyl]amino]-,(2S)-,compd. with N-cyclohexylcyclohexanamine (1:1) (9CI) |