2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid
Modify Date: 2025-08-25 19:53:41
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid structure
|
Common Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 335-93-3 | Molecular Weight | 520.92900 | |
| Density | N/A | Boiling Point | 189ºC | |
| Molecular Formula | C8AgF15O2 | Melting Point | 52-54ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | silver perfluorooctanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 189ºC |
|---|---|
| Melting Point | 52-54ºC |
| Molecular Formula | C8AgF15O2 |
| Molecular Weight | 520.92900 |
| Exact Mass | 519.87100 |
| PSA | 26.30000 |
| LogP | 4.36800 |
| InChIKey | HXWHIGAHMKKVBV-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ag+] |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2915900090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:355-63-5
CAS#:7440-22-4| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| pentadecafluoro-octanoic acid,silver pentadecafluorooctanoate |
| Pentadecafluor-octansaeure,Silber-pentadecafluoroctanoat |