MEK inhibitor structure
|
Common Name | MEK inhibitor | ||
|---|---|---|---|---|
| CAS Number | 334951-92-7 | Molecular Weight | 426.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H26N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MEK inhibitorMEK inhibitor is a potent MEK inhibitor with antitumor potency. |
| Name | (3Z)-3-[[3-[(dimethylamino)methyl]anilino]-phenylmethylidene]-N-methyl-2-oxo-1H-indole-6-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | MEK inhibitor is a potent MEK inhibitor with antitumor potency. |
|---|---|
| Related Catalog | |
| Target |
MEK |
| Molecular Formula | C26H26N4O2 |
|---|---|
| Molecular Weight | 426.51000 |
| Exact Mass | 426.20600 |
| PSA | 80.45000 |
| LogP | 4.77320 |
| InChIKey | UPICVLXBXZXYIE-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1ccc2c(C(=Nc3cccc(CN(C)C)c3)c3ccccc3)c(O)[nH]c2c1 |
| Storage condition | 2-8℃ |
| cc-45 |
| S1530_Selleck |
| MEK inhibitor| |
| MEK inhibitor |